|
CAS#: 6222-82-8 Product: 6-Methylpregnenolone No suppilers available for the product. |
| Name | 6-Methylpregnenolone |
|---|---|
| Synonyms | Acetic Acid (17-Acetyl-6,10,13-Trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ester; (17-Ethanoyl-6,10,13-Trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ethanoate; Nsc152215 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 |
| CAS Registry Number | 6222-82-8 |
| SMILES | CC34C2C(C1C(C(C(C)=O)CC1)(C)CC2)CC(=C3CC(OC(C)=O)CC4)C |
| InChI | 1S/C24H36O3/c1-14-12-18-20-7-6-19(15(2)25)23(20,4)11-9-21(18)24(5)10-8-17(13-22(14)24)27-16(3)26/h17-21H,6-13H2,1-5H3 |
| InChIKey | GMILDXZMQHJWRG-UHFFFAOYSA-N |
| Density | 1.083g/cm3 (Cal.) |
|---|---|
| Boiling point | 458.77°C at 760 mmHg (Cal.) |
| Flash point | 195.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Methylpregnenolone |