|
CAS#: 62410-98-4 Product: (5Z,13E,15S)-9alpha,15-Dihydroxy-11-Oxoprosta-5,13-Dien-1-Oic Acid 1,15-Lactone No suppilers available for the product. |
| Name | (5Z,13E,15S)-9alpha,15-Dihydroxy-11-Oxoprosta-5,13-Dien-1-Oic Acid 1,15-Lactone |
|---|---|
| Synonyms | (1R,3Z,10S,11E,13R,16S)-10-Amyl-16-Hydroxy-9-Oxabicyclo[11.3.0]Hexadeca-3,11-Diene-8,14-Quinone; Brn 5600045; Pgd2 1,15-Lactone |
| Molecular Structure | ![]() |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.45 |
| CAS Registry Number | 62410-98-4 |
| SMILES | [C@@H]1\2[C@H]([C@@H](O)CC1=O)C\C=C/CCCC(O[C@H](/C=C2)CCCCC)=O |
| InChI | 1S/C20H30O4/c1-2-3-6-9-15-12-13-17-16(18(21)14-19(17)22)10-7-4-5-8-11-20(23)24-15/h4,7,12-13,15-18,21H,2-3,5-6,8-11,14H2,1H3/b7-4-,13-12+/t15-,16+,17+,18-/m0/s1 |
| InChIKey | HZYSFMCHNGCKLZ-OUTUXVNYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.828°C at 760 mmHg (Cal.) |
| Flash point | 180.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5Z,13E,15S)-9alpha,15-Dihydroxy-11-Oxoprosta-5,13-Dien-1-Oic Acid 1,15-Lactone |