Online Database of Chemicals from Around the World
|
CAS#: 6299-29-2 Product: 5-Bromo-4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine No suppilers available for the product. |
| Name | 5-Bromo-4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine |
|---|---|
| Synonyms | 5-Bromo-4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine; 5-Bromo-4-[(2-Chlorophenyl)Methylthio]-6-Methyl-2-Pyrimidinamine; [5-Bromo-4-[(2-Chlorobenzyl)Thio]-6-Methyl-Pyrimidin-2-Yl]Amine |
| Molecular Structure | ![CAS#: 6299-29-2, 5-Bromo-4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine](/moreStructures/6299-29-2.gif) |
| Molecular Formula | C12H11BrClN3S |
| Molecular Weight | 344.66 |
| CAS Registry Number | 6299-29-2 |
| SMILES | C1=CC=CC(=C1CSC2=C(Br)C(=NC(=N2)N)C)Cl |
| InChI | 1S/C12H11BrClN3S/c1-7-10(13)11(17-12(15)16-7)18-6-8-4-2-3-5-9(8)14/h2-5H,6H2,1H3,(H2,15,16,17) |
| InChIKey | QMAIACGEPXIEEI-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.961°C at 760 mmHg (Cal.) |
| Flash point | 256.168°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-4-[(2-Chlorophenyl)Methylsulfanyl]-6-Methyl-Pyrimidin-2-Amine |