|
CAS#: 630-70-6 Product: Iodotrinitromethane No suppilers available for the product. |
| Name | Iodotrinitromethane |
|---|---|
| Synonyms | Iodo-Trinitro-Methane; Iodotrinitromethane; Methane, Iodotrinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | CIN3O6 |
| Molecular Weight | 276.93 |
| CAS Registry Number | 630-70-6 |
| EINECS | 211-143-5 |
| SMILES | O=[N+]([O-])C(I)([N+]([O-])=O)[N+]([O-])=O |
| InChI | 1S/CIN3O6/c2-1(3(6)7,4(8)9)5(10)11 |
| InChIKey | PVYWOZWHSJHJFC-UHFFFAOYSA-N |
| Density | 2.708g/cm3 (Cal.) |
|---|---|
| Boiling point | 144.752°C at 760 mmHg (Cal.) |
| Flash point | 41.345°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iodotrinitromethane |