|
CAS#: 6301-59-3 Product: Bis(4-Bromophenyl)-Phenyl-Arsane No suppilers available for the product. |
| Name | Bis(4-Bromophenyl)-Phenyl-Arsane |
|---|---|
| Synonyms | Bis(4-Bromophenyl)-Phenyl-Arsane; Antineoplastic-42482; Nsc42482 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H13AsBr2 |
| Molecular Weight | 464.03 |
| CAS Registry Number | 6301-59-3 |
| SMILES | C3=CC=C([As](C1=CC=C(Br)C=C1)C2=CC=C(Br)C=C2)C=C3 |
| InChI | 1S/C18H13AsBr2/c20-17-10-6-15(7-11-17)19(14-4-2-1-3-5-14)16-8-12-18(21)13-9-16/h1-13H |
| InChIKey | VPVSRUFGOWUXCZ-UHFFFAOYSA-N |
| Boiling point | 444.925°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 260.451°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Bromophenyl)-Phenyl-Arsane |