|
CAS#: 63020-39-3 Product: 7,8,9,12-Tetramethylbenz[a]Anthracene No suppilers available for the product. |
| Name | 7,8,9,12-Tetramethylbenz[a]Anthracene |
|---|---|
| Synonyms | 5,6,9,10-Tetramethyl-1,2-Benzanthracene; Benz(A)Anthracene, 7,8,9,12-Tetramethyl-; Brn 3303708 |
| Molecular Structure | ![]() |
| Molecular Formula | C22H20 |
| Molecular Weight | 284.40 |
| CAS Registry Number | 63020-39-3 |
| SMILES | C4=CC3=C(C)C1=C(C=CC2=CC=CC=C12)C(=C3C(=C4C)C)C |
| InChI | 1S/C22H20/c1-13-9-11-18-16(4)22-19(15(3)21(18)14(13)2)12-10-17-7-5-6-8-20(17)22/h5-12H,1-4H3 |
| InChIKey | DFKQEQMVSBDKRB-UHFFFAOYSA-N |
| Density | 1.107g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.455°C at 760 mmHg (Cal.) |
| Flash point | 249.691°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,12-Tetramethylbenz[a]Anthracene |