|
CAS#: 63040-30-2 Product: 3-Methyl-4-acetylaminobiphenyl No suppilers available for the product. |
| Name | 3-Methyl-4-acetylaminobiphenyl |
|---|---|
| Synonyms | N-(2-Methyl-4-Phenyl-Phenyl)Acetamide; N-(2-Methyl-4-Phenyl-Phenyl)Ethanamide; 4'-Phenyl-O-Acetotoluide |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 |
| CAS Registry Number | 63040-30-2 |
| SMILES | C1=C(C(=CC=C1C2=CC=CC=C2)NC(C)=O)C |
| InChI | 1S/C15H15NO/c1-11-10-14(13-6-4-3-5-7-13)8-9-15(11)16-12(2)17/h3-10H,1-2H3,(H,16,17) |
| InChIKey | NWUDJMJMSSYCGT-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.201°C at 760 mmHg (Cal.) |
| Flash point | 240.246°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4-acetylaminobiphenyl |