|
CAS#: 6305-61-9 Product: Ethyl (E)-3-(4-Methylphenyl)But-2-Enoate No suppilers available for the product. |
| Name | Ethyl (E)-3-(4-Methylphenyl)But-2-Enoate |
|---|---|
| Synonyms | Ethyl 3-(4-Methylphenyl)But-2-Enoate; 3-(4-Methylphenyl)But-2-Enoic Acid Ethyl Ester; (E)-3-(4-Methylphenyl)But-2-Enoic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 6305-61-9 |
| SMILES | C1=CC(=CC=C1C(/C)=C/C(OCC)=O)C |
| InChI | 1S/C13H16O2/c1-4-15-13(14)9-11(3)12-7-5-10(2)6-8-12/h5-9H,4H2,1-3H3/b11-9+ |
| InChIKey | WVWVJVVXPXGLTC-PKNBQFBNSA-N |
| Density | 1.006g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.063°C at 760 mmHg (Cal.) |
| Flash point | 155.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (E)-3-(4-Methylphenyl)But-2-Enoate |