|
CAS#: 6309-98-4 Product: Avenin No suppilers available for the product. |
| Name | Avenin |
|---|---|
| Synonyms | Isopropyl N-Dimethoxyphosphorylcarbamate; N-Dimethoxyphosphorylcarbamic Acid Isopropyl Ester; Carbamic Acid, (Dimethoxyphosphinyl)-, 1-Methylethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14NO5P |
| Molecular Weight | 211.15 |
| CAS Registry Number | 6309-98-4 |
| SMILES | CC(C)OC(=O)N[P](=O)(OC)OC |
| InChI | 1S/C6H14NO5P/c1-5(2)12-6(8)7-13(9,10-3)11-4/h5H,1-4H3,(H,7,8,9) |
| InChIKey | XXRYFVCIMARHRS-UHFFFAOYSA-N |
| Density | 1.192g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Avenin |