|
CAS#: 63166-73-4 Product: Phyllanthoside No suppilers available for the product. |
| Name | Phyllanthoside |
|---|---|
| Synonyms | Ccris 670; Nsc 328426; Nsc-328426 |
| Molecular Structure | ![]() |
| Molecular Formula | C40H52O17 |
| Molecular Weight | 804.84 |
| CAS Registry Number | 63166-73-4 |
| SMILES | [C@@]17([C@@]6(O[C@@H]4[C@H]1CC[C@H](C(O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O)OC(=O)C)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C)O)OC(=O)C)O)=O)C4)C[C@H](OC(\C=C\C5=CC=CC=C5)=O)[C@@H](CO6)C)OC7 |
| InChI | 1S/C40H52O17/c1-19-17-48-40(16-28(19)54-29(43)14-11-24-9-7-6-8-10-24)39(18-49-39)26-13-12-25(15-27(26)57-40)36(47)56-38-35(34(53-23(5)42)31(45)21(3)51-38)55-37-32(46)33(52-22(4)41)30(44)20(2)50-37/h6-11,14,19-21,25-28,30-35,37-38,44-46H,12-13,15-18H2,1-5H3/b14-11+/t19-,20-,21-,25+,26-,27+,28+,30-,31-,32-,33+,34+,35-,37+,38+,39+,40+/m1/s1 |
| InChIKey | VOTNXJVGRXZYOA-XFJWYURVSA-N |
| Density | 1.412g/cm3 (Cal.) |
|---|---|
| Boiling point | 872.831°C at 760 mmHg (Cal.) |
| Flash point | 260.366°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phyllanthoside |