|
CAS#: 6317-50-6 Product: 3-(3-Hydroxy-Phenyl)-2-Methyl-Acrylic Acid No suppilers available for the product. |
| Name | 3-(3-Hydroxy-Phenyl)-2-Methyl-Acrylic Acid |
|---|---|
| Synonyms | (Z)-3-(3-Hydroxyphenyl)-2-Methyl-Prop-2-Enoic Acid; (Z)-3-(3-Hydroxyphenyl)-2-Methyl-Acrylic Acid; Nsc41717 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 |
| CAS Registry Number | 6317-50-6 |
| SMILES | C1=CC=C(C=C1\C=C(C(O)=O)\C)O |
| InChI | 1S/C10H10O3/c1-7(10(12)13)5-8-3-2-4-9(11)6-8/h2-6,11H,1H3,(H,12,13)/b7-5- |
| InChIKey | GLRRGQVHXAYKDR-ALCCZGGFSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.372°C at 760 mmHg (Cal.) |
| Flash point | 191.372°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Hydroxy-Phenyl)-2-Methyl-Acrylic Acid |