|
CAS#: 6317-12-0 Product: 2-(4-Chlorophenyl)-5,6-Dihydro-1,4-Dithiine No suppilers available for the product. |
| Name | 2-(4-Chlorophenyl)-5,6-Dihydro-1,4-Dithiine |
|---|---|
| Synonyms | Nsc40456 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9ClS2 |
| Molecular Weight | 228.75 |
| CAS Registry Number | 6317-12-0 |
| SMILES | C2=C(C1=CSCCS1)C=CC(=C2)Cl |
| InChI | 1S/C10H9ClS2/c11-9-3-1-8(2-4-9)10-7-12-5-6-13-10/h1-4,7H,5-6H2 |
| InChIKey | WXUHLHBZAGARSN-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 365.357°C at 760 mmHg (Cal.) |
| Flash point | 163.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Chlorophenyl)-5,6-Dihydro-1,4-Dithiine |