|
CAS#: 6317-69-7 Product: N,N-Dimethyl-4-(Phenylcarbohydrazonoyl)Aniline No suppilers available for the product. |
| Name | N,N-Dimethyl-4-(Phenylcarbohydrazonoyl)Aniline |
|---|---|
| Synonyms | (E)-(4-(Dimethylamino)Phenyl)(Phenyl)Methanone Hydrazone; Aids-124659; Aids124659 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 |
| CAS Registry Number | 6317-69-7 |
| SMILES | C2=C(\C(=N/N)C1=CC=CC=C1)C=CC(=C2)N(C)C |
| InChI | 1S/C15H17N3/c1-18(2)14-10-8-13(9-11-14)15(17-16)12-6-4-3-5-7-12/h3-11H,16H2,1-2H3/b17-15- |
| InChIKey | ILHLDKIEVVAISL-ICFOKQHNSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.737°C at 760 mmHg (Cal.) |
| Flash point | 188.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-(Phenylcarbohydrazonoyl)Aniline |