|
CAS#: 6317-80-2 Product: Bis(3-(Trifluoromethyl)Phenyl)(4-(Trifluoromethyl)Phenyl)Silanol No suppilers available for the product. |
| Name | Bis(3-(Trifluoromethyl)Phenyl)(4-(Trifluoromethyl)Phenyl)Silanol |
|---|---|
| Synonyms | Nsc43094; Nsc 43094; Aids-124662 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H13F9OSi |
| Molecular Weight | 480.40 |
| CAS Registry Number | 6317-80-2 |
| SMILES | C3=C([Si](C1=CC(=CC=C1)C(F)(F)F)(C2=CC=C(C(F)(F)F)C=C2)O)C=CC=C3C(F)(F)F |
| InChI | 1S/C21H13F9OSi/c22-19(23,24)13-7-9-16(10-8-13)32(31,17-5-1-3-14(11-17)20(25,26)27)18-6-2-4-15(12-18)21(28,29)30/h1-12,31H |
| InChIKey | BCLCWOAOLZFBDU-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.565°C at 760 mmHg (Cal.) |
| Flash point | 206.336°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(3-(Trifluoromethyl)Phenyl)(4-(Trifluoromethyl)Phenyl)Silanol |