|
CAS#: 63340-03-4 Product: 1-Methoxy-4-[1-(1-Methylethyl)Cyclopropyl]-Benzene No suppilers available for the product. |
| Name | 1-Methoxy-4-[1-(1-Methylethyl)Cyclopropyl]-Benzene |
|---|---|
| Synonyms | 1-(1-Isopropylcyclopropyl)-4-Methoxy-Benzene; 1-(1-Isopropylcyclopropyl)-4-Methoxybenzene; Benzene, 1-Methoxy-4-(1-(1-Methylethyl)Cyclopropyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28 |
| CAS Registry Number | 63340-03-4 |
| SMILES | C1=CC(=CC=C1C2(CC2)C(C)C)OC |
| InChI | 1S/C13H18O/c1-10(2)13(8-9-13)11-4-6-12(14-3)7-5-11/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | IPZVRJFKWVHDQG-UHFFFAOYSA-N |
| Density | 0.991g/cm3 (Cal.) |
|---|---|
| Boiling point | 260.209°C at 760 mmHg (Cal.) |
| Flash point | 114.581°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-4-[1-(1-Methylethyl)Cyclopropyl]-Benzene |