|
CAS#: 6334-11-8 Product: 2,4,6-Trimethylaniline hydrochloride No suppilers available for the product. |
| Name | 2,4,6-Trimethylaniline hydrochloride |
|---|---|
| Synonyms | (2,4,6-Trimethylphenyl)Ammonium Chloride; Mesitylammonium Chloride; 2,4,6-Trimethylaniline Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14ClN |
| Molecular Weight | 171.67 |
| CAS Registry Number | 6334-11-8 |
| SMILES | C1=C(C=C(C(=C1C)[NH3+])C)C.[Cl-] |
| InChI | 1S/C9H13N.ClH/c1-6-4-7(2)9(10)8(3)5-6;/h4-5H,10H2,1-3H3;1H |
| InChIKey | WUYJXWRFOUCHEB-UHFFFAOYSA-N |
| Boiling point | 231.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 96.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trimethylaniline hydrochloride |