|
CAS#: 63367-99-7 Product: 5-(2-(3,4-Dimethoxyphenyl)Ethyl)-2-Methoxy-Phenol No suppilers available for the product. |
| Name | 5-(2-(3,4-Dimethoxyphenyl)Ethyl)-2-Methoxy-Phenol |
|---|---|
| Synonyms | 5-[2-(3,4-Dimethoxyphenyl)Ethyl]-2-Methoxy-Phenol; Phenol, 5-(2-(3,4-Dimethoxyphenyl)Ethyl)-2-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 |
| CAS Registry Number | 63367-99-7 |
| SMILES | C1=C(C(=CC(=C1)CCC2=CC=C(C(=C2)OC)OC)O)OC |
| InChI | 1S/C17H20O4/c1-19-15-8-6-12(10-14(15)18)4-5-13-7-9-16(20-2)17(11-13)21-3/h6-11,18H,4-5H2,1-3H3 |
| InChIKey | UPOANTHMCQBWOE-UHFFFAOYSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.509°C at 760 mmHg (Cal.) |
| Flash point | 203.278°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-(3,4-Dimethoxyphenyl)Ethyl)-2-Methoxy-Phenol |