Online Database of Chemicals from Around the World
|
CAS#: 63373-82-0 Product: (1S-Endo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Methanol No suppilers available for the product. |
| Name | (1S-Endo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Methanol |
|---|---|
| Synonyms | [(1S)-3,3-Dimethylnorbornan-2-Yl]Methanol; [(1S)-3,3-Dimethyl-2-Norbornanyl]Methanol; (1S-Endo)-3,3-Dimethylbicyclo(2.2.1)Heptane-2-Methanol |
| Molecular Structure | ![CAS#: 63373-82-0, (1S-Endo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Methanol](/moreStructures/63373-82-0.gif) |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 63373-82-0 |
| EINECS | 264-114-4 |
| SMILES | [C@@H]12C(C(C(C1)CC2)(C)C)CO |
| InChI | 1S/C10H18O/c1-10(2)8-4-3-7(5-8)9(10)6-11/h7-9,11H,3-6H2,1-2H3/t7-,8?,9?/m0/s1 |
| InChIKey | GICBKEFIACFATK-UEJVZZJDSA-N |
| Density | 0.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.516°C at 760 mmHg (Cal.) |
| Flash point | 95.973°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S-Endo)-3,3-Dimethylbicyclo[2.2.1]Heptane-2-Methanol |