|
CAS#: 6384-18-5 Product: Dimethyl L-Aspartate No suppilers available for the product. |
| Name | Dimethyl L-Aspartate |
|---|---|
| Synonyms | (2S)-2-Aminobutanedioic Acid Dimethyl Ester; (2S)-2-Aminosuccinic Acid Dimethyl Ester; Dimethyl L-Aspartate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 6384-18-5 |
| EINECS | 228-982-8 |
| SMILES | [C@H](CC(=O)OC)(C(=O)OC)N |
| InChI | 1S/C6H11NO4/c1-10-5(8)3-4(7)6(9)11-2/h4H,3,7H2,1-2H3/t4-/m0/s1 |
| InChIKey | BYHXBBOSJKPUJL-BYPYZUCNSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.989°C at 760 mmHg (Cal.) |
| Flash point | 88.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl L-Aspartate |