|
CAS#: 63867-17-4 Product: 2-Ethylbutanoic Acid 2,2,2-Tribromoethyl Ester No suppilers available for the product. |
| Name | 2-Ethylbutanoic Acid 2,2,2-Tribromoethyl Ester |
|---|---|
| Synonyms | 2-Ethylbutanoic Acid 2,2,2-Tribromoethyl Ester; 2-Ethylbutyric Acid 2,2,2-Tribromoethyl Ester; Butyric Acid, 2-Ethyl-, 2,2,2-Tribromoethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13Br3O2 |
| Molecular Weight | 380.90 |
| CAS Registry Number | 63867-17-4 |
| SMILES | C(C)C(CC)C(=O)OCC(Br)(Br)Br |
| InChI | 1S/C8H13Br3O2/c1-3-6(4-2)7(12)13-5-8(9,10)11/h6H,3-5H2,1-2H3 |
| InChIKey | KRTPZDITOONUEW-UHFFFAOYSA-N |
| Density | 1.867g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.094°C at 760 mmHg (Cal.) |
| Flash point | 160.088°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Ethylbutanoic Acid 2,2,2-Tribromoethyl Ester |