|
CAS#: 63869-24-9 Product: Phosphoric Acid 1-(Diethoxyphosphinyl)Ethenyl dimethyl Ester No suppilers available for the product. |
| Name | Phosphoric Acid 1-(Diethoxyphosphinyl)Ethenyl dimethyl Ester |
|---|---|
| Synonyms | 1-Diethoxyphosphorylvinyl Dimethyl Phosphate; Phosphoric Acid 1-Diethoxyphosphorylvinyl Dimethyl Ester; Ent 24,416 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18O7P2 |
| Molecular Weight | 288.17 |
| CAS Registry Number | 63869-24-9 |
| SMILES | C(O[P](C(O[P](=O)(OC)OC)=C)(=O)OCC)C |
| InChI | 1S/C8H18O7P2/c1-6-13-16(9,14-7-2)8(3)15-17(10,11-4)12-5/h3,6-7H2,1-2,4-5H3 |
| InChIKey | OVPRNIRGMWIYHU-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.309°C at 760 mmHg (Cal.) |
| Flash point | 164.328°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phosphoric Acid 1-(Diethoxyphosphinyl)Ethenyl dimethyl Ester |