|
CAS#: 63887-26-3 Product: 4-Amino-3,5-Dichlorobenzamide No suppilers available for the product. |
| Name | 4-Amino-3,5-Dichlorobenzamide |
|---|---|
| Synonyms | 4-Amino-3,5-Dichloro-Benzamide; Benzamide, 4-Amino-3,5-Dichloro-; Brn 2722888 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6Cl2N2O |
| Molecular Weight | 205.04 |
| CAS Registry Number | 63887-26-3 |
| SMILES | C1=C(Cl)C(=C(Cl)C=C1C(N)=O)N |
| InChI | 1S/C7H6Cl2N2O/c8-4-1-3(7(11)12)2-5(9)6(4)10/h1-2H,10H2,(H2,11,12) |
| InChIKey | CRYCKBHVODBYAQ-UHFFFAOYSA-N |
| Density | 1.527g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.037°C at 760 mmHg (Cal.) |
| Flash point | 122.557°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-3,5-Dichlorobenzamide |