|
CAS#: 63938-47-6 Product: 2-Furancarboxylic Acid 2,2,2-Tribromoethyl Ester No suppilers available for the product. |
| Name | 2-Furancarboxylic Acid 2,2,2-Tribromoethyl Ester |
|---|---|
| Synonyms | 2-Furancarboxylic Acid 2,2,2-Tribromoethyl Ester; Furan-2-Carboxylic Acid 2,2,2-Tribromoethyl Ester; 2-Furoic Acid, 2,2,2-Tribromoethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5Br3O3 |
| Molecular Weight | 376.83 |
| CAS Registry Number | 63938-47-6 |
| SMILES | C1=C(C(OCC(Br)(Br)Br)=O)OC=C1 |
| InChI | 1S/C7H5Br3O3/c8-7(9,10)4-13-6(11)5-2-1-3-12-5/h1-3H,4H2 |
| InChIKey | CKCVDRMAADONAQ-UHFFFAOYSA-N |
| Density | 2.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 356.114°C at 760 mmHg (Cal.) |
| Flash point | 169.172°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Furancarboxylic Acid 2,2,2-Tribromoethyl Ester |