|
CAS#: 63978-53-0 Product: Ethanol Mustard No suppilers available for the product. |
| Name | Ethanol Mustard |
|---|---|
| Synonyms | 2-(Bis(2-Chloroethyl)Amino)Ethanol Hydrochloride; Bis(Beta-Chloroethyl)-Beta-Hydroxyethylamine Hydrochloride; Ethanol, 2-(Bis(2-Chloroethyl)Amino)-, Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14Cl3NO |
| Molecular Weight | 222.54 |
| CAS Registry Number | 63978-53-0 |
| SMILES | [H+].C(N(CCCl)CCCl)CO.[Cl-] |
| InChI | 1S/C6H13Cl2NO.ClH/c7-1-3-9(4-2-8)5-6-10;/h10H,1-6H2;1H |
| InChIKey | DECSLTUASJOEBZ-UHFFFAOYSA-N |
| Boiling point | 202.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 76°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethanol Mustard |