|
CAS#: 63979-80-6 Product: 2-Mercaptosuccinic Acid Diisopropyl Ester No suppilers available for the product. |
| Name | 2-Mercaptosuccinic Acid Diisopropyl Ester |
|---|---|
| Synonyms | Diisopropyl 2-Sulfanylbutanedioate; 2-Mercaptobutanedioic Acid Diisopropyl Ester; 2-Mercaptosuccinic Acid Diisopropyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O4S |
| Molecular Weight | 234.31 |
| CAS Registry Number | 63979-80-6 |
| SMILES | C(C(=O)OC(C)C)C(C(OC(C)C)=O)S |
| InChI | 1S/C10H18O4S/c1-6(2)13-9(11)5-8(15)10(12)14-7(3)4/h6-8,15H,5H2,1-4H3 |
| InChIKey | SBVKAWKHZQJWKU-UHFFFAOYSA-N |
| Density | 1.086g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.849°C at 760 mmHg (Cal.) |
| Flash point | 178.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Mercaptosuccinic Acid Diisopropyl Ester |