Online Database of Chemicals from Around the World
|
CAS#: 63992-61-0 Product: 4,6-Dichloro-5-Methyl-1,3-Benzenediol No suppilers available for the product. |
| Name | 4,6-Dichloro-5-Methyl-1,3-Benzenediol |
|---|---|
| Synonyms | 4,6-Dichloro-5-Methyl-Benzene-1,3-Diol; 4,6-Dichloro-5-Methyl-Resorcinol; 4-06-00-05893 (Beilstein Handbook Reference) |
| Molecular Structure |  |
| Molecular Formula | C7H6Cl2O2 |
| Molecular Weight | 193.03 |
| CAS Registry Number | 63992-61-0 |
| SMILES | C1=C(O)C(=C(C(=C1O)Cl)C)Cl |
| InChI | 1S/C7H6Cl2O2/c1-3-6(8)4(10)2-5(11)7(3)9/h2,10-11H,1H3 |
| InChIKey | IVNCPSRGNXBTPP-UHFFFAOYSA-N |
| Density | 1.526g/cm3 (Cal.) |
|---|---|
| Boiling point | 294.37°C at 760 mmHg (Cal.) |
| Flash point | 131.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-5-Methyl-1,3-Benzenediol |