|
CAS#: 63992-62-1 Product: 2,4,6-Trichloro-5-Methyl-1,3-Benzenediol No suppilers available for the product. |
| Name | 2,4,6-Trichloro-5-Methyl-1,3-Benzenediol |
|---|---|
| Synonyms | 2,4,6-Trichloro-5-Methyl-Benzene-1,3-Diol; 2,4,6-Trichloro-5-Methyl-Resorcinol; 5-Methyl-2,4,6-Trichlororesorcinol |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5Cl3O2 |
| Molecular Weight | 227.47 |
| CAS Registry Number | 63992-62-1 |
| SMILES | CC1=C(Cl)C(=C(Cl)C(=C1Cl)O)O |
| InChI | 1S/C7H5Cl3O2/c1-2-3(8)6(11)5(10)7(12)4(2)9/h11-12H,1H3 |
| InChIKey | ADPSWGPDSRWGHE-UHFFFAOYSA-N |
| Density | 1.643g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.66°C at 760 mmHg (Cal.) |
| Flash point | 128.378°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trichloro-5-Methyl-1,3-Benzenediol |