|
CAS#: 64258-02-2 Product: 1,3,5-Tribromo-2-(4-Bromophenyl)Benzene No suppilers available for the product. |
| Name | 1,3,5-Tribromo-2-(4-Bromophenyl)Benzene |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,4,4',6-Tetrabromo-; 2,4,4',6-Tetrabromo-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.80 |
| CAS Registry Number | 64258-02-2 |
| SMILES | C1=C(C(=C(C=C1Br)Br)C2=CC=C(C=C2)Br)Br |
| InChI | 1S/C12H6Br4/c13-8-3-1-7(2-4-8)12-10(15)5-9(14)6-11(12)16/h1-6H |
| InChIKey | QOYZOHLNXSXCTO-UHFFFAOYSA-N |
| Density | 2.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.878°C at 760 mmHg (Cal.) |
| Flash point | 195.298°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,5-Tribromo-2-(4-Bromophenyl)Benzene |