|
CAS#: 644-48-4 Product: Abequose No suppilers available for the product. |
| Name | Abequose |
|---|---|
| Synonyms | (3R,5R,6R)-6-Methyltetrahydropyran-2,3,5-Triol; 3,6-Deoxy-D-Xylo-Hexose; 3,6-Deoxy-D-Galactose |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 |
| CAS Registry Number | 644-48-4 (56816-60-5) |
| SMILES | [C@@H]1(C(O)O[C@@H]([C@H](O)C1)C)O |
| InChI | 1S/C6H12O4/c1-3-4(7)2-5(8)6(9)10-3/h3-9H,2H2,1H3/t3-,4-,5-,6?/m1/s1 |
| InChIKey | KYPWIZMAJMNPMJ-JDJSBBGDSA-N |
| Density | 1.366g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.623°C at 760 mmHg (Cal.) |
| Flash point | 139.845°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Abequose |