|
CAS#: 64601-05-4 Product: Potassium p-Chloro-m-Cresolate No suppilers available for the product. |
| Name | Potassium p-Chloro-m-Cresolate |
|---|---|
| Synonyms | Potassium 4-Chloro-3-Methyl-Phenolate; Potassium P-Chloro-M-Cresolate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClKO |
| Molecular Weight | 180.67 |
| CAS Registry Number | 64601-05-4 |
| EINECS | 264-953-6 |
| SMILES | C1=C(C(=CC=C1[O-])Cl)C.[K+] |
| InChI | 1S/C7H7ClO.K/c1-5-4-6(9)2-3-7(5)8;/h2-4,9H,1H3;/q;+1/p-1 |
| InChIKey | LWLZWMKAWVRECC-UHFFFAOYSA-M |
| Boiling point | 235°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 93.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Potassium p-Chloro-m-Cresolate |