|
CAS#: 6466-20-2 Product: 3,7-Dihydro-1,3-Dimethyl-8-(Methylthio)-1H-Purine-2,6-Dithione No suppilers available for the product. |
| Name | 3,7-Dihydro-1,3-Dimethyl-8-(Methylthio)-1H-Purine-2,6-Dithione |
|---|---|
| Synonyms | 1,3-Dimethyl-8-(Methylthio)-7H-Purine-2,6-Dithione; Brn 1125485; Nsc 95860 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N4S3 |
| Molecular Weight | 258.37 |
| CAS Registry Number | 6466-20-2 |
| SMILES | CN1C2=C(C(N(C1=S)C)=S)[NH]C(=N2)SC |
| InChI | 1S/C8H10N4S3/c1-11-5-4(9-7(10-5)15-3)6(13)12(2)8(11)14/h1-3H3,(H,9,10) |
| InChIKey | OSNIQHVTMKAFJZ-UHFFFAOYSA-N |
| Density | 1.587g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.713°C at 760 mmHg (Cal.) |
| Flash point | 235.455°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dihydro-1,3-Dimethyl-8-(Methylthio)-1H-Purine-2,6-Dithione |