|
CAS#: 64666-98-4 Product: Arnottin I No suppilers available for the product. |
| Name | Arnottin I |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H14O6 |
| Molecular Weight | 350.33 |
| CAS Registry Number | 64666-98-4 |
| SMILES | C1=CC5=C(C2=C1C3=C(C(O2)=O)C(=C(OC)C=C3)OC)C=C4OCOC4=C5 |
| InChI | 1S/C20H14O6/c1-22-14-6-5-11-12-4-3-10-7-15-16(25-9-24-15)8-13(10)18(12)26-20(21)17(11)19(14)23-2/h3-8H,9H2,1-2H3 |
| InChIKey | AOYQXCYLRJFNFX-UHFFFAOYSA-N |
| Density | 1.419g/cm3 (Cal.) |
|---|---|
| Boiling point | 586.328°C at 760 mmHg (Cal.) |
| Flash point | 260.476°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Arnottin I |