|
CAS#: 65520-56-1 Product: gamma-Glutamyl Tyramine No suppilers available for the product. |
| Name | gamma-Glutamyl Tyramine |
|---|---|
| Synonyms | (2S)-5-Amino-2-[2-(4-Hydroxyphenyl)Ethylamino]-5-Oxo-Pentanoic Acid; (2S)-5-Amino-2-[2-(4-Hydroxyphenyl)Ethylamino]-5-Keto-Valeric Acid; L-Glutamine, N-(2-(4-Hydroxyphenyl)Ethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 |
| CAS Registry Number | 65520-56-1 |
| SMILES | [C@H](C(=O)O)(NCCC1=CC=C(C=C1)O)CCC(=O)N |
| InChI | 1S/C13H18N2O4/c14-12(17)6-5-11(13(18)19)15-8-7-9-1-3-10(16)4-2-9/h1-4,11,15-16H,5-8H2,(H2,14,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | HSYMWRKZTLQPMR-NSHDSACASA-N |
| Density | 1.281g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.62°C at 760 mmHg (Cal.) |
| Flash point | 312.205°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for gamma-Glutamyl Tyramine |