|
CAS#: 65646-26-6 Product: Feruloyltyramine No suppilers available for the product. |
| Name | Feruloyltyramine |
|---|---|
| Synonyms | (E)-3-(4-Hydroxy-3-Methoxyphenyl)-N-[2-(4-Hydroxyphenyl)Ethyl]Prop-2-Enamide; 3-(4-Hydroxy-3-Methoxy-Phenyl)-N-[2-(4-Hydroxyphenyl)Ethyl]Prop-2-Enamide; (E)-3-(4-Hydroxy-3-Methoxy-Phenyl)-N-[2-(4-Hydroxyphenyl)Ethyl]Prop-2-Enamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 |
| CAS Registry Number | 65646-26-6 |
| SMILES | C2=C(\C=C\C(=O)NCCC1=CC=C(O)C=C1)C=CC(=C2OC)O |
| InChI | 1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
| InChIKey | NPNNKDMSXVRADT-WEVVVXLNSA-N |
| Density | 1.249g/cm3 (Cal.) |
|---|---|
| Boiling point | 603.286°C at 760 mmHg (Cal.) |
| Flash point | 318.656°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Feruloyltyramine |