|
CAS#: 65652-42-8 Product: Dichloro(Benzyl)Benzene No suppilers available for the product. |
| Name | Dichloro(Benzyl)Benzene |
|---|---|
| Synonyms | 1-(Benzyl)-2,4-Dichloro-Benzene; (Dichlorophenyl)Phenylmethane; Benzene, Dichloro(Phenylmethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10Cl2 |
| Molecular Weight | 237.13 |
| CAS Registry Number | 65652-42-8 |
| EINECS | 265-860-3 |
| SMILES | C1=C(C(=CC(=C1)Cl)Cl)CC2=CC=CC=C2 |
| InChI | 1S/C13H10Cl2/c14-12-7-6-11(13(15)9-12)8-10-4-2-1-3-5-10/h1-7,9H,8H2 |
| InChIKey | LQUWZOKGGJISJF-UHFFFAOYSA-N |
| Density | 1.23g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.661°C at 760 mmHg (Cal.) |
| Flash point | 139.045°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloro(Benzyl)Benzene |