|
CAS#: 6587-80-0 Product: 1',3'-Dihydro-7-Methoxy-1',3',3'-Trimethyl-6-Nitrospiro[2H-1-Benzopyran-2,2'-[2H]Indole] No suppilers available for the product. |
| Name | 1',3'-Dihydro-7-Methoxy-1',3',3'-Trimethyl-6-Nitrospiro[2H-1-Benzopyran-2,2'-[2H]Indole] |
|---|---|
| Synonyms | 7-Methoxy-1',3',3'-Trimethyl-6-Nitro-Spiro[Chromene-2,2'-Indoline]; 7-Methoxy-1',3',3'-Trimethyl-6-Nitrospiro[Chromene-2,2'-Indoline]; 7-Methoxy-1',3',3'-Trimethyl-6-Nitro-Spiro[Chromene-2,2'-Indole] |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 |
| CAS Registry Number | 6587-80-0 |
| EINECS | 229-518-7 |
| SMILES | C1=CC=CC4=C1C(C3(OC2=CC(=C([N+]([O-])=O)C=C2C=C3)OC)N4C)(C)C |
| InChI | 1S/C20H20N2O4/c1-19(2)14-7-5-6-8-15(14)21(3)20(19)10-9-13-11-16(22(23)24)18(25-4)12-17(13)26-20/h5-12H,1-4H3 |
| InChIKey | YVXQOVOKDWEDNL-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 512.27°C at 760 mmHg (Cal.) |
| Flash point | 263.611°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1',3'-Dihydro-7-Methoxy-1',3',3'-Trimethyl-6-Nitrospiro[2H-1-Benzopyran-2,2'-[2H]Indole] |