|
CAS#: 65916-16-7 Product: 5-Aminonaphthyl Sulphate No suppilers available for the product. |
| Name | 5-Aminonaphthyl Sulphate |
|---|---|
| Synonyms | 5-Amino-1-Naphthalenol; Sulfuric Acid; 5-Amino-1-Naphthol; Sulfuric Acid; 1-Amino-5-Hydroxynaphthalene, Sulfuric Acid Salt (2:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.45 |
| CAS Registry Number | 65916-16-7 |
| EINECS | 265-981-1 |
| SMILES | O=[S](=O)(O)O.C1=C2C(=C(O)C=C1)C=CC=C2N.C3=C4C(=C(O)C=C3)C=CC=C4N |
| InChI | 1S/2C10H9NO.H2O4S/c2*11-9-5-1-4-8-7(9)3-2-6-10(8)12;1-5(2,3)4/h2*1-6,12H,11H2;(H2,1,2,3,4) |
| InChIKey | PWJIPMNRMOEOEP-UHFFFAOYSA-N |
| Boiling point | 378.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 182.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Aminonaphthyl Sulphate |