|
CAS#: 66635-40-3 Product: 4,4'-Vinylenedianilinium Dichloride No suppilers available for the product. |
| Name | 4,4'-Vinylenedianilinium Dichloride |
|---|---|
| Synonyms | [4-[(E)-2-(4-Azaniumylphenyl)Vinyl]Phenyl]Ammonium Dichloride; [4-[(E)-2-(4-Ammoniophenyl)Vinyl]Phenyl]Ammonium Dichloride |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 |
| CAS Registry Number | 66635-40-3 |
| EINECS | 266-431-3 |
| SMILES | C2=C(\C=C\C1=CC=C([NH3+])C=C1)C=CC(=C2)[NH3+].[Cl-].[Cl-] |
| InChI | 1S/C14H14N2.2ClH/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12;;/h1-10H,15-16H2;2*1H/b2-1+;; |
| InChIKey | QHDAFTKIEDDTPV-SEPHDYHBSA-N |
| Boiling point | 438.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 262.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Vinylenedianilinium Dichloride |