|
CAS#: 67049-69-8 Product: 3',4'-Dihydroxy-2-methylbutyrophenone No suppilers available for the product. |
| Name | 3',4'-Dihydroxy-2-methylbutyrophenone |
|---|---|
| Synonyms | 1-(3,4-Dihydroxyphenyl)-2-Methyl-Butan-1-One; Butyrophenone, 3',4'-Dihydroxy-2-Methyl-; 3',4'-Dihydroxy-2-Methylbutyrophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 |
| CAS Registry Number | 67049-69-8 |
| SMILES | C1=C(O)C(=CC=C1C(=O)C(CC)C)O |
| InChI | 1S/C11H14O3/c1-3-7(2)11(14)8-4-5-9(12)10(13)6-8/h4-7,12-13H,3H2,1-2H3 |
| InChIKey | OEQYBTLDHVLHOC-UHFFFAOYSA-N |
| Density | 1.158g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.99°C at 760 mmHg (Cal.) |
| Flash point | 198.39°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',4'-Dihydroxy-2-methylbutyrophenone |