|
CAS#: 67239-27-4 Product: Cyclopentyl-3,4-Dihydroxyphenylketone No suppilers available for the product. |
| Name | Cyclopentyl-3,4-Dihydroxyphenylketone |
|---|---|
| Synonyms | Brn 2580210; Cyclopentyl 3,4-Dihydroxyphenyl Ketone; Ketone, Cyclopentyl 3,4-Dihydroxyphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 |
| CAS Registry Number | 67239-27-4 |
| SMILES | C2=C(C(=O)C1CCCC1)C=CC(=C2O)O |
| InChI | 1S/C12H14O3/c13-10-6-5-9(7-11(10)14)12(15)8-3-1-2-4-8/h5-8,13-14H,1-4H2 |
| InChIKey | ICPUNZJSJWFCOT-UHFFFAOYSA-N |
| Density | 1.268g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.238°C at 760 mmHg (Cal.) |
| Flash point | 226.329°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cyclopentyl-3,4-Dihydroxyphenylketone |