Online Database of Chemicals from Around the World
|
CAS#: 67252-82-8 Product: 1,2,2a,3a-Tetrahydrochryseno(3,4-b)oxirene-1,2-diol No suppilers available for the product. |
| Name | 1,2,2a,3a-Tetrahydrochryseno(3,4-b)oxirene-1,2-diol |
|---|---|
| Synonyms | 1,2,2A,3A-Tetrahydrochryseno(3,4-B)Oxirene-1,2-Diol; Anti-Cde; Chryseno(3,4-B)Oxirene-1,2-Diol, 1,2,2A,3A-Tetrahydro- |
| Molecular Structure |  |
| Molecular Formula | C18H14O3 |
| Molecular Weight | 278.31 |
| CAS Registry Number | 67252-82-8 |
| SMILES | C4=CC3=C2C1C(O1)C(C(C2=CC=C3C5=C4C=CC=C5)O)O |
| InChI | 1S/C18H14O3/c19-15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)17-18(21-17)16(15)20/h1-8,15-20H |
| InChIKey | KPTYXJLOWLVCMU-UHFFFAOYSA-N |
| Density | 1.478g/cm3 (Cal.) |
|---|---|
| Boiling point | 567.46°C at 760 mmHg (Cal.) |
| Flash point | 296.99°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,2a,3a-Tetrahydrochryseno(3,4-b)oxirene-1,2-diol |