Online Database of Chemicals from Around the World
| No suppilers available for the product. |
| Name | 1,2,3,4,8-Pentachloro-dibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,3,4,8-Pentachloro; Brn 5079795; Dibenzofuran, 1,2,3,4,8-Pentachloro- |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl5O |
| Molecular Weight | 340.42 |
| CAS Registry Number | 67517-48-0 |
| SMILES | C1=C2C(=CC=C1Cl)OC3=C2C(=C(C(=C3Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O/c13-4-1-2-6-5(3-4)7-8(14)9(15)10(16)11(17)12(7)18-6/h1-3H |
| InChIKey | ZCTNDJSCLPJCRA-UHFFFAOYSA-N |
| Desity | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.109°C at 760 mmHg (Cal.) |
| Flash point | 223.599°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,8-Pentachloro-dibenzofuran |