|
CAS#: 67719-38-4 Product: 11-Fluoro-11-Dehydroxyprostaglandin F2alpha No suppilers available for the product. |
| Name | 11-Fluoro-11-Dehydroxyprostaglandin F2alpha |
|---|---|
| Synonyms | 11-Fluoro-11-Dehydroxyprostaglandin F2alpha; Prosta-5,13-Dien-1-Oic Acid, 11-Fluoro-9,15-Dihydroxy-, (5Z,9Alpha,11Alpha,13E,15S)-; 11-Fluoro-11-Dehydroxy-Pgf2alpha |
| Molecular Structure | ![]() |
| Molecular Formula | C20H33FO4 |
| Molecular Weight | 356.48 |
| CAS Registry Number | 67719-38-4 |
| SMILES | [C@H]1([C@H]([C@@H](O)C[C@H]1F)C\C=C/CCCC(=O)O)\C=C\[C@@H](O)CCCCC |
| InChI | 1S/C20H33FO4/c1-2-3-6-9-15(22)12-13-16-17(19(23)14-18(16)21)10-7-4-5-8-11-20(24)25/h4,7,12-13,15-19,22-23H,2-3,5-6,8-11,14H2,1H3,(H,24,25)/b7-4-,13-12+/t15-,16+,17+,18+,19-/m0/s1 |
| InChIKey | CIIQBCUKZGIWTN-WTKFZEAQSA-N |
| Density | 1.105g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.857°C at 760 mmHg (Cal.) |
| Flash point | 266.991°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11-Fluoro-11-Dehydroxyprostaglandin F2alpha |