|
CAS#: 67764-17-4 Product: 4'-Fluoro-N-Hydroxy-(1,1'-Biphenyl)-4-Amine No suppilers available for the product. |
| Name | 4'-Fluoro-N-Hydroxy-(1,1'-Biphenyl)-4-Amine |
|---|---|
| Synonyms | (1,1'-Biphenyl)-4-Amine, 4'-Fluoro-N-Hydroxy-; 4'-Fluoro-N-Hydroxy-(1,1'-Biphenyl)-4-Amine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10FNO |
| Molecular Weight | 203.22 |
| CAS Registry Number | 67764-17-4 |
| SMILES | C1=CC(=CC=C1C2=CC=C(C=C2)F)NO |
| InChI | 1S/C12H10FNO/c13-11-5-1-9(2-6-11)10-3-7-12(14-15)8-4-10/h1-8,14-15H |
| InChIKey | IULOHIPZNLKUSQ-UHFFFAOYSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 346.645°C at 760 mmHg (Cal.) |
| Flash point | 163.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Fluoro-N-Hydroxy-(1,1'-Biphenyl)-4-Amine |