|
CAS#: 67824-38-8 Product: (S)-2-(Chloromethyl)-1-Methylpyrrolidinium Chloride No suppilers available for the product. |
| Name | (S)-2-(Chloromethyl)-1-Methylpyrrolidinium Chloride |
|---|---|
| Synonyms | 2-(Chloromethyl)-1-Methyl-Pyrrolidin-1-Ium Chloride; (S)-2-(Chloromethyl)-1-Methylpyrrolidinium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H13Cl2N |
| Molecular Weight | 170.08 |
| CAS Registry Number | 67824-38-8 (54288-69-6) |
| EINECS | 267-217-2 |
| SMILES | C(Cl)C1[NH+](C)CCC1.[Cl-] |
| InChI | 1S/C6H12ClN.ClH/c1-8-4-2-3-6(8)5-7;/h6H,2-5H2,1H3;1H |
| InChIKey | JMYYNTRVGBDWDB-UHFFFAOYSA-N |
| Boiling point | 159°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 50°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (S)-2-(Chloromethyl)-1-Methylpyrrolidinium Chloride |