|
CAS#: 67828-37-9 Product: Methyl 2,4-Dihydroxyphenylglycolate No suppilers available for the product. |
| Name | Methyl 2,4-Dihydroxyphenylglycolate |
|---|---|
| Synonyms | Methyl 2-(2,4-Dihydroxyphenyl)-2-Oxo-Acetate; 2-(2,4-Dihydroxyphenyl)-2-Oxoacetic Acid Methyl Ester; 2-(2,4-Dihydroxyphenyl)-2-Keto-Acetic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8O5 |
| Molecular Weight | 196.16 |
| CAS Registry Number | 67828-37-9 |
| EINECS | 267-260-7 |
| SMILES | C1=CC(=C(C=C1O)O)C(=O)C(=O)OC |
| InChI | 1S/C9H8O5/c1-14-9(13)8(12)6-3-2-5(10)4-7(6)11/h2-4,10-11H,1H3 |
| InChIKey | DTTXYTFSERGEPB-UHFFFAOYSA-N |
| Density | 1.423g/cm3 (Cal.) |
|---|---|
| Boiling point | 369.8°C at 760 mmHg (Cal.) |
| Flash point | 151.894°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,4-Dihydroxyphenylglycolate |