|
CAS#: 6784-46-9 Product: Farnesylamine No suppilers available for the product. |
| Name | Farnesylamine |
|---|---|
| Synonyms | [(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-Trienyl]Amine; 2,6,10-Dodecatrien-1-Amine, 3,7,11-Trimethyl-; Farnesylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 |
| CAS Registry Number | 6784-46-9 |
| SMILES | C(\C=C(\CC\C=C(\CCC=C(C)C)C)C)N |
| InChI | 1S/C15H27N/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-16/h7,9,11H,5-6,8,10,12,16H2,1-4H3/b14-9+,15-11+ |
| InChIKey | BDKQVCHNTAJNJR-YFVJMOTDSA-N |
| Density | 0.851g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.501°C at 760 mmHg (Cal.) |
| Flash point | 137.223°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Farnesylamine |