|
CAS#: 67845-31-2 Product: Butanoic Acid 1,3,3-Trimethylbicyclo[2.2.1]Heptan-2-Yl Ester No suppilers available for the product. |
| Name | Butanoic Acid 1,3,3-Trimethylbicyclo[2.2.1]Heptan-2-Yl Ester |
|---|---|
| Synonyms | (1,3,3-Trimethylnorbornan-2-Yl) Butanoate; Butanoic Acid (1,3,3-Trimethyl-2-Norbornanyl) Ester; Butyric Acid (1,3,3-Trimethylnorbornan-2-Yl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 67845-31-2 |
| SMILES | C(C(OC2C1(CC(CC1)C2(C)C)C)=O)CC |
| InChI | 1S/C14H24O2/c1-5-6-11(15)16-12-13(2,3)10-7-8-14(12,4)9-10/h10,12H,5-9H2,1-4H3 |
| InChIKey | CQNXIFHRYNSUGB-UHFFFAOYSA-N |
| Density | 0.986g/cm3 (Cal.) |
|---|---|
| Boiling point | 253.984°C at 760 mmHg (Cal.) |
| Flash point | 110.943°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Butanoic Acid 1,3,3-Trimethylbicyclo[2.2.1]Heptan-2-Yl Ester |