|
CAS#: 67906-38-1 Product: 4-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Butyl Methacrylate No suppilers available for the product. |
| Name | 4-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Butyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptylsulfonyl)Amino)Butyl Ester; 2-Methylacrylic Acid 4-(Methyl-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptylsulfonyl)Amino)Butyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16F15NO4S |
| Molecular Weight | 603.34 |
| CAS Registry Number | 67906-38-1 |
| EINECS | 267-705-5 |
| SMILES | C(N([S](=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C)CCCOC(=O)C(=C)C |
| InChI | 1S/C16H16F15NO4S/c1-8(2)9(33)36-7-5-4-6-32(3)37(34,35)16(30,31)14(25,26)12(21,22)10(17,18)11(19,20)13(23,24)15(27,28)29/h1,4-7H2,2-3H3 |
| InChIKey | CRGIYPZDEQHQFH-UHFFFAOYSA-N |
| Density | 1.503g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.268°C at 760 mmHg (Cal.) |
| Flash point | 184.385°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Methyl[(Pentadecafluoroheptyl)Sulphonyl]Amino]Butyl Methacrylate |