|
CAS#: 67923-53-9 Product: 4-(2,4,6-Trimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-Ol No suppilers available for the product. |
| Name | 4-(2,4,6-Trimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-Ol |
|---|---|
| Synonyms | 3-Buten-2-Ol, 4-(2,4,6-Trimethyl-3-Cyclohexen-1-Yl)-; 4-(2,4,6-Trimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 |
| CAS Registry Number | 67923-53-9 |
| EINECS | 267-768-9 |
| SMILES | CC1C(C(CC(=C1)C)C)\C=C\C(O)C |
| InChI | 1S/C13H22O/c1-9-7-10(2)13(11(3)8-9)6-5-12(4)14/h5-7,10-14H,8H2,1-4H3/b6-5+ |
| InChIKey | WQTLBWPUJXRBIN-AATRIKPKSA-N |
| Density | 0.934g/cm3 (Cal.) |
|---|---|
| Boiling point | 273.583°C at 760 mmHg (Cal.) |
| Flash point | 101.302°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2,4,6-Trimethyl-3-Cyclohexen-1-Yl)-3-Buten-2-Ol |